C18H21NO3 — CID 102434288
(1S,2R,6R,7R,8R,11S)-4-[(4-methoxyphenyl)methyl]-12-oxa-4-azatetracyclo[5.4.1.02,6.08,11]dodecan-3-one (PubChem CID 102434288) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (1S,2R,6R,7R,8R,11S)-4-[(4-methoxyphenyl)methyl]-12-oxa-4-azatetracyclo[5.4.1.02,6.08,11]dodecan-3-one.
| Compound Name | (1S,2R,6R,7R,8R,11S)-4-[(4-methoxyphenyl)methyl]-12-oxa-4-azatetracyclo[5.4.1.02,6.08,11]dodecan-3-one |
|---|---|
| PubChem CID | 102434288 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (1S,2R,6R,7R,8R,11S)-4-[(4-methoxyphenyl)methyl]-12-oxa-4-azatetracyclo[5.4.1.02,6.08,11]dodecan-3-one |
| SMILES | COc1ccc(CN2C[C@@H]3[C@@H]4O[C@@H]([C@H]5CC[C@H]54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C18H21NO3/c1-21-11-4-2-10(3-5-11)8-19-9-14-15(18(19)20)17-13-7-6-12(13)16(14)22-17/h2-5,12-17H,6-9H2,1H3/t12-,13+,14+,15-,16-,17+/m1/s1 |
| InChIKey | KITYCYXLIQREBN-YTLBIWTGSA-N |
| XLogP | 2.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |