C28H27NO2 — CID 46178711
(3aS,6R,7S,7aR)-2-[(4-methoxyphenyl)methyl]-6,7-diphenyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one (PubChem CID 46178711) has the molecular formula C28H27NO2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (3aS,6R,7S,7aR)-2-[(4-methoxyphenyl)methyl]-6,7-diphenyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one.
| Compound Name | (3aS,6R,7S,7aR)-2-[(4-methoxyphenyl)methyl]-6,7-diphenyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 46178711 |
| Molecular Formula | C28H27NO2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (3aS,6R,7S,7aR)-2-[(4-methoxyphenyl)methyl]-6,7-diphenyl-3a,6,7,7a-tetrahydro-3H-isoindol-1-one |
| SMILES | COc1ccc(CN2C[C@H]3C=C[C@@H](c4ccccc4)[C@H](c4ccccc4)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C28H27NO2/c1-31-24-15-12-20(13-16-24)18-29-19-23-14-17-25(21-8-4-2-5-9-21)26(27(23)28(29)30)22-10-6-3-7-11-22/h2-17,23,25-27H,18-19H2,1H3/t23-,25+,26+,27+/m1/s1 |
| InChIKey | UYVOZJDBSVDIES-BDGPUAICSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|