C12H18ClNO2 — CID 10243524
methyl (4aS,7S,7aR)-2,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridin-2-ium-4-carboxylate chloride (PubChem CID 10243524) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is methyl (4aS,7S,7aR)-2,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridin-2-ium-4-carboxylate chloride.
| Compound Name | methyl (4aS,7S,7aR)-2,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridin-2-ium-4-carboxylate chloride |
|---|---|
| PubChem CID | 10243524 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | methyl (4aS,7S,7aR)-2,7-dimethyl-5,6,7,7a-tetrahydro-4aH-cyclopenta[c]pyridin-2-ium-4-carboxylate chloride |
| SMILES | COC(=O)C1=C[N+](C)=C[C@H]2[C@@H]1CC[C@@H]2C.[Cl-] |
| InChI | InChI=1S/C12H18NO2.ClH/c1-8-4-5-9-10(8)6-13(2)7-11(9)12(14)15-3;/h6-10H,4-5H2,1-3H3;1H/q+1;/p-1/t8-,9-,10+;/m0./s1 |
| InChIKey | CVMXZVYHWLNNIR-OAINAWNSSA-M |
| XLogP | -1.56 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|