C18H28O9 — CID 163046495
methyl 7-methyl-1-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 163046495) has the molecular formula C18H28O9 and a molecular weight of 388.41 g/mol. Its IUPAC name is methyl 7-methyl-1-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 7-methyl-1-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 163046495 |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 7-methyl-1-[3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COCC1OC(OC2OC=C(C(=O)OC)C3CCC(C)C23)C(O)C(O)C1O |
| InChI | InChI=1S/C18H28O9/c1-8-4-5-9-10(16(22)24-3)6-25-17(12(8)9)27-18-15(21)14(20)13(19)11(26-18)7-23-2/h6,8-9,11-15,17-21H,4-5,7H2,1-3H3 |
| InChIKey | CJZXQEWILILGPN-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |