C20H33ClN2 — CID 102435306
trans-(1R,2R)-1-N-[(4-chlorophenyl)methyl]-2-N-heptan-2-ylcyclohexane-1,2-diamine (PubChem CID 102435306) has the molecular formula C20H33ClN2 and a molecular weight of 336.95 g/mol. Its IUPAC name is trans-(1R,2R)-1-N-[(4-chlorophenyl)methyl]-2-N-heptan-2-ylcyclohexane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N-[(4-chlorophenyl)methyl]-2-N-heptan-2-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 102435306 |
| Molecular Formula | C20H33ClN2 |
| Molecular Weight | 336.95 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | trans-(1R,2R)-1-N-[(4-chlorophenyl)methyl]-2-N-heptan-2-ylcyclohexane-1,2-diamine |
| SMILES | CCCCCC(C)N[C@@H]1CCCC[C@H]1NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H33ClN2/c1-3-4-5-8-16(2)23-20-10-7-6-9-19(20)22-15-17-11-13-18(21)14-12-17/h11-14,16,19-20,22-23H,3-10,15H2,1-2H3/t16?,19-,20-/m1/s1 |
| InChIKey | XWQNLZZYWXRGLX-ODFWGIBRSA-N |
| XLogP | 5.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.95 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|