C14H18O2 — CID 102436648
(1R,6R,9R)-6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodecane-2,8-dione (PubChem CID 102436648) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1R,6R,9R)-6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodecane-2,8-dione.
| Compound Name | (1R,6R,9R)-6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodecane-2,8-dione |
|---|---|
| PubChem CID | 102436648 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1R,6R,9R)-6-methyl-10-methylidenetricyclo[7.2.1.01,6]dodecane-2,8-dione |
| SMILES | C=C1C[C@]23C[C@H]1C(=O)C[C@@]2(C)CCCC3=O |
| InChI | InChI=1S/C14H18O2/c1-9-6-14-7-10(9)11(15)8-13(14,2)5-3-4-12(14)16/h10H,1,3-8H2,2H3/t10-,13-,14-/m1/s1 |
| InChIKey | NPIHLINUJXXXRC-LERXQTSPSA-N |
| XLogP | 2.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|