C11H14O2 — CID 130765311
(1R,6R)-tricyclo[4.4.1.01,6]undecane-2,7-dione (PubChem CID 130765311) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (1R,6R)-tricyclo[4.4.1.01,6]undecane-2,7-dione.
| Compound Name | (1R,6R)-tricyclo[4.4.1.01,6]undecane-2,7-dione |
|---|---|
| PubChem CID | 130765311 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (1R,6R)-tricyclo[4.4.1.01,6]undecane-2,7-dione |
| SMILES | O=C1CCC[C@@]23C[C@@]12CCCC3=O |
| InChI | InChI=1S/C11H14O2/c12-8-3-1-5-10-7-11(8,10)6-2-4-9(10)13/h1-7H2/t10-,11-/m0/s1 |
| InChIKey | AIFNJWWTOYBWRP-QWRGUYRKSA-N |
| XLogP | 1.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |