C12H25N3O — CID 102437932
N-butyl-2-propan-2-yl-1,3-diazinane-1-carboxamide (PubChem CID 102437932) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is N-butyl-2-propan-2-yl-1,3-diazinane-1-carboxamide.
| Compound Name | N-butyl-2-propan-2-yl-1,3-diazinane-1-carboxamide |
|---|---|
| PubChem CID | 102437932 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N-butyl-2-propan-2-yl-1,3-diazinane-1-carboxamide |
| SMILES | CCCCNC(=O)N1CCCNC1C(C)C |
| InChI | InChI=1S/C12H25N3O/c1-4-5-7-14-12(16)15-9-6-8-13-11(15)10(2)3/h10-11,13H,4-9H2,1-3H3,(H,14,16) |
| InChIKey | OYHHFRLSNTUQLE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|