C23H32N2O5 — CID 102440497
ethyl 2-[(4aR,11cR)-1-(2-hydroxyethyl)-8,9-dimethoxy-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-4a-yl]acetate (PubChem CID 102440497) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethyl 2-[(4aR,11cR)-1-(2-hydroxyethyl)-8,9-dimethoxy-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-4a-yl]acetate.
| Compound Name | ethyl 2-[(4aR,11cR)-1-(2-hydroxyethyl)-8,9-dimethoxy-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-4a-yl]acetate |
|---|---|
| PubChem CID | 102440497 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | ethyl 2-[(4aR,11cR)-1-(2-hydroxyethyl)-8,9-dimethoxy-3,4,5,6,7,11c-hexahydro-2H-pyrido[3,2-c]carbazol-4a-yl]acetate |
| SMILES | CCOC(=O)C[C@]12CCCN(CCO)[C@H]1c1c([nH]c3c(OC)c(OC)ccc13)CC2 |
| InChI | InChI=1S/C23H32N2O5/c1-4-30-18(27)14-23-9-5-11-25(12-13-26)22(23)19-15-6-7-17(28-2)21(29-3)20(15)24-16(19)8-10-23/h6-7,22,24,26H,4-5,8-14H2,1-3H3/t22-,23+/m0/s1 |
| InChIKey | VTHCZNQGZQFNDG-XZOQPEGZSA-N |
| XLogP | 3.20 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|