C18H15F6NO2S — CID 102440579
1,1,1,3,3,3-hexafluoropropan-2-yl (3S)-3-(2-aminophenyl)sulfanyl-3-phenylpropanoate (PubChem CID 102440579) has the molecular formula C18H15F6NO2S and a molecular weight of 423.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl (3S)-3-(2-aminophenyl)sulfanyl-3-phenylpropanoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3S)-3-(2-aminophenyl)sulfanyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 102440579 |
| Molecular Formula | C18H15F6NO2S |
| Molecular Weight | 423.38 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl (3S)-3-(2-aminophenyl)sulfanyl-3-phenylpropanoate |
| SMILES | Nc1ccccc1S[C@@H](CC(=O)OC(C(F)(F)F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C18H15F6NO2S/c19-17(20,21)16(18(22,23)24)27-15(26)10-14(11-6-2-1-3-7-11)28-13-9-5-4-8-12(13)25/h1-9,14,16H,10,25H2/t14-/m0/s1 |
| InChIKey | KISCLVYFKAOPLL-AWEZNQCLSA-N |
| XLogP | 5.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|