C16H14F2NO4S2- — CID 9238984
3-[4-[[2-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoate (PubChem CID 9238984) has the molecular formula C16H14F2NO4S2- and a molecular weight of 386.42 g/mol. Its IUPAC name is 3-[4-[[2-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoate.
| Compound Name | 3-[4-[[2-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 9238984 |
| Molecular Formula | C16H14F2NO4S2- |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 3-[4-[[2-(difluoromethylsulfanyl)phenyl]sulfamoyl]phenyl]propanoate |
| SMILES | O=C([O-])CCc1ccc(S(=O)(=O)Nc2ccccc2SC(F)F)cc1 |
| InChI | InChI=1S/C16H15F2NO4S2/c17-16(18)24-14-4-2-1-3-13(14)19-25(22,23)12-8-5-11(6-9-12)7-10-15(20)21/h1-6,8-9,16,19H,7,10H2,(H,20,21)/p-1 |
| InChIKey | VUFDQSVSOFZLMD-UHFFFAOYSA-M |
| XLogP | 2.48 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |