C15H13FNO4S- — CID 7516424
3-[4-[(2-fluorophenyl)sulfamoyl]phenyl]propanoate (PubChem CID 7516424) has the molecular formula C15H13FNO4S- and a molecular weight of 322.34 g/mol. Its IUPAC name is 3-[4-[(2-fluorophenyl)sulfamoyl]phenyl]propanoate.
| Compound Name | 3-[4-[(2-fluorophenyl)sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 7516424 |
| Molecular Formula | C15H13FNO4S- |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-[4-[(2-fluorophenyl)sulfamoyl]phenyl]propanoate |
| SMILES | O=C([O-])CCc1ccc(S(=O)(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C15H14FNO4S/c16-13-3-1-2-4-14(13)17-22(20,21)12-8-5-11(6-9-12)7-10-15(18)19/h1-6,8-9,17H,7,10H2,(H,18,19)/p-1 |
| InChIKey | MTGXMLZFVFYMTI-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |