C15H16N2O4S — CID 3112772
2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 3112772) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 3112772 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | Nc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C15H16N2O4S/c16-12-6-8-13(9-7-12)22(20,21)17-14(15(18)19)10-11-4-2-1-3-5-11/h1-9,14,17H,10,16H2,(H,18,19) |
| InChIKey | AAWOKTGNZABRTQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|