C15H16N2O4S — CID 3112772
N-(4-Aminobenzene-1-sulfonyl)phenylalanine (PubChem CID 3112772) has the molecular formula C15H16N2O4S and a molecular weight of 320.40 g/mol. Its IUPAC name is 2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | N-(4-Aminobenzene-1-sulfonyl)phenylalanine |
|---|---|
| PubChem CID | 3112772 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | C1=CC=C(C=C1)CC(C(=O)O)NS(=O)(=O)C2=CC=C(C=C2)N |
| InChI | InChI=1S/C15H16N2O4S/c16-12-6-8-13(9-7-12)22(20,21)17-14(15(18)19)10-11-4-2-1-3-5-11/h1-9,14,17H,10,16H2,(H,18,19) |
| InChIKey | AAWOKTGNZABRTQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 460 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|