C16H17N3O4S2 — CID 11794109
(2S)-3-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid (PubChem CID 11794109) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 11794109 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | (2S)-3-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)N[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H17N3O4S2/c17-25(22,23)13-8-6-12(7-9-13)18-16(24)19-14(15(20)21)10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H,20,21)(H2,17,22,23)(H2,18,19,24)/t14-/m0/s1 |
| InChIKey | XLMNAJDPYXDADN-AWEZNQCLSA-N |
| XLogP | 1.32 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|