C13H19N3O4S2 — CID 10497717
(2S)-4-methyl-2-[(4-sulfamoylphenyl)carbamothioylamino]pentanoic acid (PubChem CID 10497717) has the molecular formula C13H19N3O4S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is (2S)-4-methyl-2-[(4-sulfamoylphenyl)carbamothioylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[(4-sulfamoylphenyl)carbamothioylamino]pentanoic acid |
|---|---|
| PubChem CID | 10497717 |
| Molecular Formula | C13H19N3O4S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (2S)-4-methyl-2-[(4-sulfamoylphenyl)carbamothioylamino]pentanoic acid |
| SMILES | CC(C)C[C@H](NC(=S)Nc1ccc(S(N)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H19N3O4S2/c1-8(2)7-11(12(17)18)16-13(21)15-9-3-5-10(6-4-9)22(14,19)20/h3-6,8,11H,7H2,1-2H3,(H,17,18)(H2,14,19,20)(H2,15,16,21)/t11-/m0/s1 |
| InChIKey | FCIOTDXBRZKMDG-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|