C10H13N3O4S2 — CID 10494655
3-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid (PubChem CID 10494655) has the molecular formula C10H13N3O4S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 3-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid.
| Compound Name | 3-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid |
|---|---|
| PubChem CID | 10494655 |
| Molecular Formula | C10H13N3O4S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 3-[(4-sulfamoylphenyl)carbamothioylamino]propanoic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NCCC(=O)O)cc1 |
| InChI | InChI=1S/C10H13N3O4S2/c11-19(16,17)8-3-1-7(2-4-8)13-10(18)12-6-5-9(14)15/h1-4H,5-6H2,(H,14,15)(H2,11,16,17)(H2,12,13,18) |
| InChIKey | FQRCVIJHGCLTJK-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|