C15H15N3O4S2 — CID 3489403
2-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]acetic acid (PubChem CID 3489403) has the molecular formula C15H15N3O4S2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]acetic acid.
| Compound Name | 2-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]acetic acid |
|---|---|
| PubChem CID | 3489403 |
| Molecular Formula | C15H15N3O4S2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-phenyl-2-[(4-sulfamoylphenyl)carbamothioylamino]acetic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)NC(C(=O)O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H15N3O4S2/c16-24(21,22)12-8-6-11(7-9-12)17-15(23)18-13(14(19)20)10-4-2-1-3-5-10/h1-9,13H,(H,19,20)(H2,16,21,22)(H2,17,18,23) |
| InChIKey | LDKNESVHONOUJK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|