C12H15N3O4S2 — CID 10568362
(2S)-1-[(4-sulfamoylphenyl)carbamothioyl]pyrrolidine-2-carboxylic acid (PubChem CID 10568362) has the molecular formula C12H15N3O4S2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S)-1-[(4-sulfamoylphenyl)carbamothioyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(4-sulfamoylphenyl)carbamothioyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10568362 |
| Molecular Formula | C12H15N3O4S2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | (2S)-1-[(4-sulfamoylphenyl)carbamothioyl]pyrrolidine-2-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(NC(=S)N2CCC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C12H15N3O4S2/c13-21(18,19)9-5-3-8(4-6-9)14-12(20)15-7-1-2-10(15)11(16)17/h3-6,10H,1-2,7H2,(H,14,20)(H,16,17)(H2,13,18,19)/t10-/m0/s1 |
| InChIKey | VHZVQRFYYPOCQY-JTQLQIEISA-N |
| XLogP | 0.58 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|