C7H9NO2 — CID 102440708
(3aS,7aS)-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-2-one (PubChem CID 102440708) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (3aS,7aS)-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-2-one.
| Compound Name | (3aS,7aS)-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 102440708 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (3aS,7aS)-3a,4,7,7a-tetrahydro-3H-1,3-benzoxazol-2-one |
| SMILES | O=C1N[C@H]2CC=CC[C@@H]2O1 |
| InChI | InChI=1S/C7H9NO2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-2,5-6H,3-4H2,(H,8,9)/t5-,6-/m0/s1 |
| InChIKey | RNSQTZOLYLEKKQ-WDSKDSINSA-N |
| XLogP | 0.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|