C21H20FN3O — CID 102440811
(2R)-5-(4-fluorophenyl)-2-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-6-one (PubChem CID 102440811) has the molecular formula C21H20FN3O and a molecular weight of 349.41 g/mol. Its IUPAC name is (2R)-5-(4-fluorophenyl)-2-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-6-one.
| Compound Name | (2R)-5-(4-fluorophenyl)-2-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-6-one |
|---|---|
| PubChem CID | 102440811 |
| Molecular Formula | C21H20FN3O |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2R)-5-(4-fluorophenyl)-2-methyl-5,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-6-one |
| SMILES | C[C@]12CCN(c3ccc(F)cc3)C(=O)N1CCc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C21H20FN3O/c1-21-11-13-24(15-8-6-14(22)7-9-15)20(26)25(21)12-10-17-16-4-2-3-5-18(16)23-19(17)21/h2-9,23H,10-13H2,1H3/t21-/m1/s1 |
| InChIKey | PAVQADBXAJKDOZ-OAQYLSRUSA-N |
| XLogP | 4.41 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |