C38H64N6O2+2 — CID 102441197
1-(10-pyridin-1-ium-1-yldecyl)-3-[(1R,2R)-2-(10-pyridin-1-ium-1-yldecylcarbamoylamino)cyclohexyl]urea (PubChem CID 102441197) has the molecular formula C38H64N6O2+2 and a molecular weight of 636.97 g/mol. Its IUPAC name is 1-(10-pyridin-1-ium-1-yldecyl)-3-[(1R,2R)-2-(10-pyridin-1-ium-1-yldecylcarbamoylamino)cyclohexyl]urea.
| Compound Name | 1-(10-pyridin-1-ium-1-yldecyl)-3-[(1R,2R)-2-(10-pyridin-1-ium-1-yldecylcarbamoylamino)cyclohexyl]urea |
|---|---|
| PubChem CID | 102441197 |
| Molecular Formula | C38H64N6O2+2 |
| Molecular Weight | 636.97 g/mol |
| Exact Mass | 636.51 |
| IUPAC Name | 1-(10-pyridin-1-ium-1-yldecyl)-3-[(1R,2R)-2-(10-pyridin-1-ium-1-yldecylcarbamoylamino)cyclohexyl]urea |
| SMILES | O=C(NCCCCCCCCCC[n+]1ccccc1)N[C@@H]1CCCC[C@H]1NC(=O)NCCCCCCCCCC[n+]1ccccc1 |
| InChI | InChI=1S/C38H62N6O2/c45-37(39-27-17-9-5-1-3-7-11-19-29-43-31-21-13-22-32-43)41-35-25-15-16-26-36(35)42-38(46)40-28-18-10-6-2-4-8-12-20-30-44-33-23-14-24-34-44/h13-14,21-24,31-36H,1-12,15-20,25-30H2,(H2-2,39,40,41,42,45,46)/p+2/t35-,36-/m1/s1 |
| InChIKey | PMKQNBCZSZIELR-LQFQNGICSA-P |
| XLogP | 7.11 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.97 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|