C22H40N4O2 — CID 102018358
1-but-3-enyl-3-[(1R,2R)-2-(dec-9-enylcarbamoylamino)cyclohexyl]urea (PubChem CID 102018358) has the molecular formula C22H40N4O2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-but-3-enyl-3-[(1R,2R)-2-(dec-9-enylcarbamoylamino)cyclohexyl]urea.
| Compound Name | 1-but-3-enyl-3-[(1R,2R)-2-(dec-9-enylcarbamoylamino)cyclohexyl]urea |
|---|---|
| PubChem CID | 102018358 |
| Molecular Formula | C22H40N4O2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | 1-but-3-enyl-3-[(1R,2R)-2-(dec-9-enylcarbamoylamino)cyclohexyl]urea |
| SMILES | C=CCCCCCCCCNC(=O)N[C@@H]1CCCC[C@H]1NC(=O)NCCC=C |
| InChI | InChI=1S/C22H40N4O2/c1-3-5-7-8-9-10-11-14-18-24-22(28)26-20-16-13-12-15-19(20)25-21(27)23-17-6-4-2/h3-4,19-20H,1-2,5-18H2,(H2,23,25,27)(H2,24,26,28)/t19-,20-/m1/s1 |
| InChIKey | CHZIIBAOBCNBSD-WOJBJXKFSA-N |
| XLogP | 4.39 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|