C12H20N2O4 — CID 122016567
4-[[(2S,3R)-2-ethenyloxan-3-yl]carbamoylamino]butanoic acid (PubChem CID 122016567) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[[(2S,3R)-2-ethenyloxan-3-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[(2S,3R)-2-ethenyloxan-3-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122016567 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-[[(2S,3R)-2-ethenyloxan-3-yl]carbamoylamino]butanoic acid |
| SMILES | C=C[C@@H]1OCCC[C@H]1NC(=O)NCCCC(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-2-10-9(5-4-8-18-10)14-12(17)13-7-3-6-11(15)16/h2,9-10H,1,3-8H2,(H,15,16)(H2,13,14,17)/t9-,10+/m1/s1 |
| InChIKey | KHFADJLIJVDTAM-ZJUUUORDSA-N |
| XLogP | 0.88 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|