C35H66N2O2 — CID 122377021
2-heptyl-N-[(1R,2R)-2-(undec-10-enoylamino)cyclohexyl]undecanamide (PubChem CID 122377021) has the molecular formula C35H66N2O2 and a molecular weight of 546.93 g/mol. Its IUPAC name is 2-heptyl-N-[(1R,2R)-2-(undec-10-enoylamino)cyclohexyl]undecanamide.
| Compound Name | 2-heptyl-N-[(1R,2R)-2-(undec-10-enoylamino)cyclohexyl]undecanamide |
|---|---|
| PubChem CID | 122377021 |
| Molecular Formula | C35H66N2O2 |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.51 |
| IUPAC Name | 2-heptyl-N-[(1R,2R)-2-(undec-10-enoylamino)cyclohexyl]undecanamide |
| SMILES | C=CCCCCCCCCC(=O)N[C@@H]1CCCC[C@H]1NC(=O)C(CCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C35H66N2O2/c1-4-7-10-13-15-17-20-23-30-34(38)36-32-28-24-25-29-33(32)37-35(39)31(26-21-18-12-9-6-3)27-22-19-16-14-11-8-5-2/h4,31-33H,1,5-30H2,2-3H3,(H,36,38)(H,37,39)/t31?,32-,33-/m1/s1 |
| InChIKey | AIAILOZCZLNNHV-HCMUIWFFSA-N |
| XLogP | 9.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|