C74H138N2O4 — CID 123155855
2-butyl-N-[(1S,2S)-2-[7-[2-[8-[(1S,2S)-2-(3-butyl-2-oxononyl)cyclohexyl]-7-oxooctyl]-4,5-dioctylcyclohexyl]heptanoylamino]cyclohexyl]octanamide (PubChem CID 123155855) has the molecular formula C74H138N2O4 and a molecular weight of 1119.93 g/mol. Its IUPAC name is 2-butyl-N-[(1S,2S)-2-[7-[2-[8-[(1S,2S)-2-(3-butyl-2-oxononyl)cyclohexyl]-7-oxooctyl]-4,5-dioctylcyclohexyl]heptanoylamino]cyclohexyl]octanamide.
| Compound Name | 2-butyl-N-[(1S,2S)-2-[7-[2-[8-[(1S,2S)-2-(3-butyl-2-oxononyl)cyclohexyl]-7-oxooctyl]-4,5-dioctylcyclohexyl]heptanoylamino]cyclohexyl]octanamide |
|---|---|
| PubChem CID | 123155855 |
| Molecular Formula | C74H138N2O4 |
| Molecular Weight | 1119.93 g/mol |
| Exact Mass | 1119.07 |
| IUPAC Name | 2-butyl-N-[(1S,2S)-2-[7-[2-[8-[(1S,2S)-2-(3-butyl-2-oxononyl)cyclohexyl]-7-oxooctyl]-4,5-dioctylcyclohexyl]heptanoylamino]cyclohexyl]octanamide |
| SMILES | CCCCCCCCC1CC(CCCCCCC(=O)C[C@@H]2CCCC[C@H]2CC(=O)C(CCCC)CCCCCC)C(CCCCCCC(=O)N[C@H]2CCCC[C@@H]2NC(=O)C(CCCC)CCCCCC)CC1CCCCCCCC |
| InChI | InChI=1S/C74H138N2O4/c1-7-13-19-23-25-33-47-63-57-65(49-35-27-29-37-53-69(77)59-67-51-39-40-52-68(67)60-72(78)61(43-17-11-5)45-31-21-15-9-3)66(58-64(63)48-34-26-24-20-14-8-2)50-36-28-30-38-56-73(79)75-70-54-41-42-55-71(70)76-74(80)62(44-18-12-6)46-32-22-16-10-4/h61-68,70-71H,7-60H2,1-6H3,(H,75,79)(H,76,80)/t61?,62?,63?,64?,65?,66?,67-,68-,70-,71-/m0/s1 |
| InChIKey | FLGDVWRMTNGINM-YUFRGFFMSA-N |
| XLogP | 22.25 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1119.93 |
| LogP ≤ 5 | 22.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|