C28H36N2O4 — CID 102441493
4-(2,3,5,6-tetrapropoxy-4-pyridin-4-ylphenyl)pyridine (PubChem CID 102441493) has the molecular formula C28H36N2O4 and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-(2,3,5,6-tetrapropoxy-4-pyridin-4-ylphenyl)pyridine.
| Compound Name | 4-(2,3,5,6-tetrapropoxy-4-pyridin-4-ylphenyl)pyridine |
|---|---|
| PubChem CID | 102441493 |
| Molecular Formula | C28H36N2O4 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 4-(2,3,5,6-tetrapropoxy-4-pyridin-4-ylphenyl)pyridine |
| SMILES | CCCOc1c(OCCC)c(-c2ccncc2)c(OCCC)c(OCCC)c1-c1ccncc1 |
| InChI | InChI=1S/C28H36N2O4/c1-5-17-31-25-23(21-9-13-29-14-10-21)27(33-19-7-3)28(34-20-8-4)24(26(25)32-18-6-2)22-11-15-30-16-12-22/h9-16H,5-8,17-20H2,1-4H3 |
| InChIKey | BRLREIQMYJUNSC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |