C11H10F3N3O — CID 10244167
2-morpholin-4-yl-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 10244167) has the molecular formula C11H10F3N3O and a molecular weight of 257.21 g/mol. Its IUPAC name is 2-morpholin-4-yl-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-morpholin-4-yl-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10244167 |
| Molecular Formula | C11H10F3N3O |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-morpholin-4-yl-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1N1CCOCC1 |
| InChI | InChI=1S/C11H10F3N3O/c12-11(13,14)9-2-1-8(7-15)10(16-9)17-3-5-18-6-4-17/h1-2H,3-6H2 |
| InChIKey | MUMVLEMLHNIBNJ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |