C15H17F3N4 — CID 133381233
2-[4-(cyclopropylamino)piperidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 133381233) has the molecular formula C15H17F3N4 and a molecular weight of 310.32 g/mol. Its IUPAC name is 2-[4-(cyclopropylamino)piperidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-[4-(cyclopropylamino)piperidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 133381233 |
| Molecular Formula | C15H17F3N4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[4-(cyclopropylamino)piperidin-1-yl]-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(C(F)(F)F)nc1N1CCC(NC2CC2)CC1 |
| InChI | InChI=1S/C15H17F3N4/c16-15(17,18)13-4-1-10(9-19)14(21-13)22-7-5-12(6-8-22)20-11-2-3-11/h1,4,11-12,20H,2-3,5-8H2 |
| InChIKey | QAACICWSULKWLI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |