C34H28N2O4 — CID 102443383
ethyl 3-(2-ethoxycarbonyl-1-phenylindolizin-3-yl)-1-phenylindolizine-2-carboxylate (PubChem CID 102443383) has the molecular formula C34H28N2O4 and a molecular weight of 528.61 g/mol. Its IUPAC name is ethyl 3-(2-ethoxycarbonyl-1-phenylindolizin-3-yl)-1-phenylindolizine-2-carboxylate.
| Compound Name | ethyl 3-(2-ethoxycarbonyl-1-phenylindolizin-3-yl)-1-phenylindolizine-2-carboxylate |
|---|---|
| PubChem CID | 102443383 |
| Molecular Formula | C34H28N2O4 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | ethyl 3-(2-ethoxycarbonyl-1-phenylindolizin-3-yl)-1-phenylindolizine-2-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)c2ccccn2c1-c1c(C(=O)OCC)c(-c2ccccc2)c2ccccn12 |
| InChI | InChI=1S/C34H28N2O4/c1-3-39-33(37)29-27(23-15-7-5-8-16-23)25-19-11-13-21-35(25)31(29)32-30(34(38)40-4-2)28(24-17-9-6-10-18-24)26-20-12-14-22-36(26)32/h5-22H,3-4H2,1-2H3 |
| InChIKey | DOLDLXXVPFOETC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |