About (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate (PubChem CID 118436458) has the molecular formula C19H21F3N2O2
and a molecular weight of 366.38 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate.
Molecular Properties
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate |
| PubChem CID | 118436458 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate |
| SMILES | CN1C2CCC1CC(OC(=O)c1cn(CC(F)F)c3ccc(F)cc13)C2 |
| InChI | InChI=1S/C19H21F3N2O2/c1-23-12-3-4-13(23)8-14(7-12)26-19(25)16-9-24(10-18(21)22)17-5-2-11(20)6-15(16)17/h2,5-6,9,12-14,18H,3-4,7-8,10H2,1H3 |
| InChIKey | ZOWAFKAFRKQHIU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate?
The IUPAC name of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate (CID 118436458) is (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate.
What is the SMILES notation for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate?
The canonical SMILES for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate is CN1C2CCC1CC(OC(=O)c1cn(CC(F)F)c3ccc(F)cc13)C2.
What is the InChIKey of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate?
The InChIKey is ZOWAFKAFRKQHIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N2O2/c1-23-12-3-4-13(23)8-14(7-12)26-19(25)16-9-24(10-18(21)22)17-5-2-11(20)6-15(16)17/h2,5-6,9,12-14,18H,3-4,7-8,10H2,1H3.
What are the key properties of (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate?
(8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate has a molecular weight of 366.38 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (8-methyl-8-azabicyclo[3.2.1]octan-3-yl) 1-(2,2-difluoroethyl)-5-fluoroindole-3-carboxylate is sourced from PubChem (CID 118436458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).