C16H19NO4 — CID 102443648
ethyl 2-[(4S,5S)-2-oxo-5-phenyl-3-prop-2-enyl-1,3-oxazolidin-4-yl]acetate (PubChem CID 102443648) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl 2-[(4S,5S)-2-oxo-5-phenyl-3-prop-2-enyl-1,3-oxazolidin-4-yl]acetate.
| Compound Name | ethyl 2-[(4S,5S)-2-oxo-5-phenyl-3-prop-2-enyl-1,3-oxazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 102443648 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl 2-[(4S,5S)-2-oxo-5-phenyl-3-prop-2-enyl-1,3-oxazolidin-4-yl]acetate |
| SMILES | C=CCN1C(=O)O[C@@H](c2ccccc2)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C16H19NO4/c1-3-10-17-13(11-14(18)20-4-2)15(21-16(17)19)12-8-6-5-7-9-12/h3,5-9,13,15H,1,4,10-11H2,2H3/t13-,15-/m0/s1 |
| InChIKey | GOOYEXHEALPFIM-ZFWWWQNUSA-N |
| XLogP | 2.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|