C7H12N2O2Se — CID 102443917
1,3-bis(2-hydroxyethyl)imidazole-2-selone (PubChem CID 102443917) has the molecular formula C7H12N2O2Se and a molecular weight of 235.14 g/mol. Its IUPAC name is 1,3-bis(2-hydroxyethyl)imidazole-2-selone.
| Compound Name | 1,3-bis(2-hydroxyethyl)imidazole-2-selone |
|---|---|
| PubChem CID | 102443917 |
| Molecular Formula | C7H12N2O2Se |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | 1,3-bis(2-hydroxyethyl)imidazole-2-selone |
| SMILES | OCCn1ccn(CCO)c1=[Se] |
| InChI | InChI=1S/C7H12N2O2Se/c10-5-3-8-1-2-9(4-6-11)7(8)12/h1-2,10-11H,3-6H2 |
| InChIKey | XEIRZISFTMXVMU-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|