C26H56N2O2 — CID 102443929
N,N,N',N'-tetrabutyldecane-1,10-diamine oxide (PubChem CID 102443929) has the molecular formula C26H56N2O2 and a molecular weight of 428.75 g/mol. Its IUPAC name is N,N,N',N'-tetrabutyldecane-1,10-diamine oxide.
| Compound Name | N,N,N',N'-tetrabutyldecane-1,10-diamine oxide |
|---|---|
| PubChem CID | 102443929 |
| Molecular Formula | C26H56N2O2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.43 |
| IUPAC Name | N,N,N',N'-tetrabutyldecane-1,10-diamine oxide |
| SMILES | CCCC[N+]([O-])(CCCC)CCCCCCCCCC[N+]([O-])(CCCC)CCCC |
| InChI | InChI=1S/C26H56N2O2/c1-5-9-21-27(29,22-10-6-2)25-19-17-15-13-14-16-18-20-26-28(30,23-11-7-3)24-12-8-4/h5-26H2,1-4H3 |
| InChIKey | RWIIFBTVNCCMLA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|