C42H46O8 — CID 102444036
2,5-diethyl-2,5-bis[(4-methoxyphenyl)methoxy]-3,4-bis[(E)-2-phenylethenyl]hexanedioic acid (PubChem CID 102444036) has the molecular formula C42H46O8 and a molecular weight of 678.82 g/mol. Its IUPAC name is 2,5-diethyl-2,5-bis[(4-methoxyphenyl)methoxy]-3,4-bis[(E)-2-phenylethenyl]hexanedioic acid.
| Compound Name | 2,5-diethyl-2,5-bis[(4-methoxyphenyl)methoxy]-3,4-bis[(E)-2-phenylethenyl]hexanedioic acid |
|---|---|
| PubChem CID | 102444036 |
| Molecular Formula | C42H46O8 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | 2,5-diethyl-2,5-bis[(4-methoxyphenyl)methoxy]-3,4-bis[(E)-2-phenylethenyl]hexanedioic acid |
| SMILES | CCC(OCc1ccc(OC)cc1)(C(=O)O)C(/C=C/c1ccccc1)C(/C=C/c1ccccc1)C(CC)(OCc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C42H46O8/c1-5-41(39(43)44,49-29-33-17-23-35(47-3)24-18-33)37(27-21-31-13-9-7-10-14-31)38(28-22-32-15-11-8-12-16-32)42(6-2,40(45)46)50-30-34-19-25-36(48-4)26-20-34/h7-28,37-38H,5-6,29-30H2,1-4H3,(H,43,44)(H,45,46)/b27-21+,28-22+ |
| InChIKey | CXVADGLWLWTYQG-GPAWKIAZSA-N |
| XLogP | 8.56 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |