C25H28N4O3 — CID 53376762
(E)-N-[(4-methoxyphenyl)methoxy]-3-[1-[(E)-1-phenylhex-1-en-3-yl]triazol-4-yl]prop-2-enamide (PubChem CID 53376762) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is (E)-N-[(4-methoxyphenyl)methoxy]-3-[1-[(E)-1-phenylhex-1-en-3-yl]triazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[(4-methoxyphenyl)methoxy]-3-[1-[(E)-1-phenylhex-1-en-3-yl]triazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 53376762 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | (E)-N-[(4-methoxyphenyl)methoxy]-3-[1-[(E)-1-phenylhex-1-en-3-yl]triazol-4-yl]prop-2-enamide |
| SMILES | CCCC(/C=C/c1ccccc1)n1cc(/C=C/C(=O)NOCc2ccc(OC)cc2)nn1 |
| InChI | InChI=1S/C25H28N4O3/c1-3-7-23(14-10-20-8-5-4-6-9-20)29-18-22(26-28-29)13-17-25(30)27-32-19-21-11-15-24(31-2)16-12-21/h4-6,8-18,23H,3,7,19H2,1-2H3,(H,27,30)/b14-10+,17-13+ |
| InChIKey | WUSJNNAUYCPGNB-JTOAUJHISA-N |
| XLogP | 4.60 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|