C21H19N5O3S — CID 57387782
(E)-3-[1-(1,3-benzothiazol-2-ylmethyl)triazol-4-yl]-N-[(4-methoxyphenyl)methoxy]prop-2-enamide (PubChem CID 57387782) has the molecular formula C21H19N5O3S and a molecular weight of 421.48 g/mol. Its IUPAC name is (E)-3-[1-(1,3-benzothiazol-2-ylmethyl)triazol-4-yl]-N-[(4-methoxyphenyl)methoxy]prop-2-enamide.
| Compound Name | (E)-3-[1-(1,3-benzothiazol-2-ylmethyl)triazol-4-yl]-N-[(4-methoxyphenyl)methoxy]prop-2-enamide |
|---|---|
| PubChem CID | 57387782 |
| Molecular Formula | C21H19N5O3S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (E)-3-[1-(1,3-benzothiazol-2-ylmethyl)triazol-4-yl]-N-[(4-methoxyphenyl)methoxy]prop-2-enamide |
| SMILES | COc1ccc(CONC(=O)/C=C/c2cn(Cc3nc4ccccc4s3)nn2)cc1 |
| InChI | InChI=1S/C21H19N5O3S/c1-28-17-9-6-15(7-10-17)14-29-24-20(27)11-8-16-12-26(25-23-16)13-21-22-18-4-2-3-5-19(18)30-21/h2-12H,13-14H2,1H3,(H,24,27)/b11-8+ |
| InChIKey | SNPJREVIFLIMAE-DHZHZOJOSA-N |
| XLogP | 3.21 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|