C12H10N4O2S — CID 103107574
methyl 1-(1,3-benzothiazol-2-ylmethyl)triazole-4-carboxylate (PubChem CID 103107574) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl 1-(1,3-benzothiazol-2-ylmethyl)triazole-4-carboxylate.
| Compound Name | methyl 1-(1,3-benzothiazol-2-ylmethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103107574 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 1-(1,3-benzothiazol-2-ylmethyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2nc3ccccc3s2)nn1 |
| InChI | InChI=1S/C12H10N4O2S/c1-18-12(17)9-6-16(15-14-9)7-11-13-8-4-2-3-5-10(8)19-11/h2-6H,7H2,1H3 |
| InChIKey | CNXFAPUHIAZUFZ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |