C22H24N2O5 — CID 102445544
5-O-benzyl 1-O-methyl (1R,3S,4S,7S,10R)-3-(furan-2-yl)-2,5-diazatricyclo[5.2.1.04,10]decane-1,5-dicarboxylate (PubChem CID 102445544) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 5-O-benzyl 1-O-methyl (1R,3S,4S,7S,10R)-3-(furan-2-yl)-2,5-diazatricyclo[5.2.1.04,10]decane-1,5-dicarboxylate.
| Compound Name | 5-O-benzyl 1-O-methyl (1R,3S,4S,7S,10R)-3-(furan-2-yl)-2,5-diazatricyclo[5.2.1.04,10]decane-1,5-dicarboxylate |
|---|---|
| PubChem CID | 102445544 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-O-benzyl 1-O-methyl (1R,3S,4S,7S,10R)-3-(furan-2-yl)-2,5-diazatricyclo[5.2.1.04,10]decane-1,5-dicarboxylate |
| SMILES | COC(=O)[C@@]12CC[C@@H]3CN(C(=O)OCc4ccccc4)[C@@H]([C@@H]31)[C@@H](c1ccco1)N2 |
| InChI | InChI=1S/C22H24N2O5/c1-27-20(25)22-10-9-15-12-24(21(26)29-13-14-6-3-2-4-7-14)19(17(15)22)18(23-22)16-8-5-11-28-16/h2-8,11,15,17-19,23H,9-10,12-13H2,1H3/t15-,17-,18-,19+,22-/m1/s1 |
| InChIKey | LHVMCQHRZMYHPI-SDLUEBNPSA-N |
| XLogP | 2.88 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |