C16H30O3 — CID 102445941
1-butoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane (PubChem CID 102445941) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-butoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane.
| Compound Name | 1-butoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane |
|---|---|
| PubChem CID | 102445941 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-butoxy-2,2-bis[[(E)-prop-1-enoxy]methyl]butane |
| SMILES | C/C=C/OCC(CC)(CO/C=C/C)COCCCC |
| InChI | InChI=1S/C16H30O3/c1-5-9-12-19-15-16(8-4,13-17-10-6-2)14-18-11-7-3/h6-7,10-11H,5,8-9,12-15H2,1-4H3/b10-6+,11-7+ |
| InChIKey | VCCNRPBDARAYMH-JMQWPVDRSA-N |
| XLogP | 4.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|