About CID 102447003
CID 102447003 (PubChem CID 102447003) has the molecular formula C18H16NO
and a molecular weight of 262.33 g/mol.
Molecular Properties
| Compound Name | CID 102447003 |
| PubChem CID | 102447003 |
| Molecular Formula | C18H16NO |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc(C(=C)C(=C)c2ccc(CN=O)cc2)cc1 |
| InChI | InChI=1S/C18H16NO/c1-13-4-8-17(9-5-13)14(2)15(3)18-10-6-16(7-11-18)12-19-20/h4-11H,1-3,12H2 |
| InChIKey | YZFCSYSBURPJLN-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 102447003 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102447003?
The IUPAC name of CID 102447003 (CID 102447003) is not available.
What is the SMILES notation for CID 102447003?
The canonical SMILES for CID 102447003 is [CH2]c1ccc(C(=C)C(=C)c2ccc(CN=O)cc2)cc1.
What is the InChIKey of CID 102447003?
The InChIKey is YZFCSYSBURPJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16NO/c1-13-4-8-17(9-5-13)14(2)15(3)18-10-6-16(7-11-18)12-19-20/h4-11H,1-3,12H2.
What are the key properties of CID 102447003?
CID 102447003 has a molecular weight of 262.33 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102447003 is sourced from PubChem (CID 102447003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).