C11H18O2 — CID 102448096
(4R)-4-hexyl-3,4-dihydropyran-2-one (PubChem CID 102448096) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4R)-4-hexyl-3,4-dihydropyran-2-one.
| Compound Name | (4R)-4-hexyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 102448096 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4R)-4-hexyl-3,4-dihydropyran-2-one |
| SMILES | CCCCCC[C@H]1C=COC(=O)C1 |
| InChI | InChI=1S/C11H18O2/c1-2-3-4-5-6-10-7-8-13-11(12)9-10/h7-8,10H,2-6,9H2,1H3/t10-/m0/s1 |
| InChIKey | JUVXNXNNJADHPN-JTQLQIEISA-N |
| XLogP | 3.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|