C27H37NO4Si — CID 102450336
tert-butyl N-[(1S,2S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohex-3-en-1-yl]carbamate (PubChem CID 102450336) has the molecular formula C27H37NO4Si and a molecular weight of 467.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 102450336 |
| Molecular Formula | C27H37NO4Si |
| Molecular Weight | 467.68 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl N-[(1S,2S,6S)-2-[tert-butyl(diphenyl)silyl]oxy-6-hydroxycyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=CC[C@@H]1O |
| InChI | InChI=1S/C27H37NO4Si/c1-26(2,3)31-25(30)28-24-22(29)18-13-19-23(24)32-33(27(4,5)6,20-14-9-7-10-15-20)21-16-11-8-12-17-21/h7-17,19,22-24,29H,18H2,1-6H3,(H,28,30)/t22-,23-,24-/m0/s1 |
| InChIKey | QHRDUJKFCKNYKI-HJOGWXRNSA-N |
| XLogP | 4.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.68 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|