C11H18N2S2 — CID 102450368
2-[2-methylsulfanylethyl(pyridin-2-ylmethyl)amino]ethanethiol (PubChem CID 102450368) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 2-[2-methylsulfanylethyl(pyridin-2-ylmethyl)amino]ethanethiol.
| Compound Name | 2-[2-methylsulfanylethyl(pyridin-2-ylmethyl)amino]ethanethiol |
|---|---|
| PubChem CID | 102450368 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[2-methylsulfanylethyl(pyridin-2-ylmethyl)amino]ethanethiol |
| SMILES | CSCCN(CCS)Cc1ccccn1 |
| InChI | InChI=1S/C11H18N2S2/c1-15-9-7-13(6-8-14)10-11-4-2-3-5-12-11/h2-5,14H,6-10H2,1H3 |
| InChIKey | GXPVSPFDVYXMMZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|