C48H63IO4 — CID 102450399
11,23-ditert-butyl-4-iodo-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene (PubChem CID 102450399) has the molecular formula C48H63IO4 and a molecular weight of 830.93 g/mol. Its IUPAC name is 11,23-ditert-butyl-4-iodo-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene.
| Compound Name | 11,23-ditert-butyl-4-iodo-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene |
|---|---|
| PubChem CID | 102450399 |
| Molecular Formula | C48H63IO4 |
| Molecular Weight | 830.93 g/mol |
| Exact Mass | 830.38 |
| IUPAC Name | 11,23-ditert-butyl-4-iodo-25,26,27,28-tetrapropoxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene |
| SMILES | CCCOc1c2cccc1Cc1cc(C(C)(C)C)cc(c1OCCC)Cc1c(I)ccc(c1OCCC)Cc1cc(C(C)(C)C)cc(c1OCCC)C2 |
| InChI | InChI=1S/C48H63IO4/c1-11-20-50-43-32-16-15-17-33(43)25-36-28-40(48(8,9)10)30-38(45(36)52-22-13-3)31-41-42(49)19-18-34(46(41)53-23-14-4)26-37-29-39(47(5,6)7)27-35(24-32)44(37)51-21-12-2/h15-19,27-30H,11-14,20-26,31H2,1-10H3 |
| InChIKey | SYIQZJGCRHUFIX-UHFFFAOYSA-N |
| XLogP | 12.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.93 |
| LogP ≤ 5 | 12.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|