C22H25NO4 — CID 102450733
1-O-benzyl 2-O-tert-butyl (2S)-2-phenylazetidine-1,2-dicarboxylate (PubChem CID 102450733) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl (2S)-2-phenylazetidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl (2S)-2-phenylazetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 102450733 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl (2S)-2-phenylazetidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(c2ccccc2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4/c1-21(2,3)27-19(24)22(18-12-8-5-9-13-18)14-15-23(22)20(25)26-16-17-10-6-4-7-11-17/h4-13H,14-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | SOHUBEPBTHXMRK-QFIPXVFZSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |