C25H25BrO2 — CID 102451451
1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-4-ethylbenzene (PubChem CID 102451451) has the molecular formula C25H25BrO2 and a molecular weight of 437.38 g/mol. Its IUPAC name is 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-4-ethylbenzene.
| Compound Name | 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-4-ethylbenzene |
|---|---|
| PubChem CID | 102451451 |
| Molecular Formula | C25H25BrO2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-[(E)-1-bromo-3,3-bis(4-methoxyphenyl)prop-1-enyl]-4-ethylbenzene |
| SMILES | CCc1ccc(/C(Br)=C\C(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H25BrO2/c1-4-18-5-7-21(8-6-18)25(26)17-24(19-9-13-22(27-2)14-10-19)20-11-15-23(28-3)16-12-20/h5-17,24H,4H2,1-3H3/b25-17+ |
| InChIKey | UPXFBUYODWWNQV-KOEQRZSOSA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |