C17H17NO5 — CID 10245155
ethyl 2-(4,5-dioxo-2-phenyl-3-prop-2-enyl-1,3-oxazolidin-2-yl)prop-2-enoate (PubChem CID 10245155) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is ethyl 2-(4,5-dioxo-2-phenyl-3-prop-2-enyl-1,3-oxazolidin-2-yl)prop-2-enoate.
| Compound Name | ethyl 2-(4,5-dioxo-2-phenyl-3-prop-2-enyl-1,3-oxazolidin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10245155 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | ethyl 2-(4,5-dioxo-2-phenyl-3-prop-2-enyl-1,3-oxazolidin-2-yl)prop-2-enoate |
| SMILES | C=CCN1C(=O)C(=O)OC1(C(=C)C(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C17H17NO5/c1-4-11-18-14(19)16(21)23-17(18,12(3)15(20)22-5-2)13-9-7-6-8-10-13/h4,6-10H,1,3,5,11H2,2H3 |
| InChIKey | BSALNGXIQXHLPC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|