C21H32O4 — CID 102456012
methyl (E,4E)-4-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyl-2-(3-methylidene-6-oxohexyl)cyclopentylidene]but-2-enoate (PubChem CID 102456012) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl (E,4E)-4-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyl-2-(3-methylidene-6-oxohexyl)cyclopentylidene]but-2-enoate.
| Compound Name | methyl (E,4E)-4-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyl-2-(3-methylidene-6-oxohexyl)cyclopentylidene]but-2-enoate |
|---|---|
| PubChem CID | 102456012 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl (E,4E)-4-[(2S,5R)-5-(2-hydroxypropan-2-yl)-2-methyl-2-(3-methylidene-6-oxohexyl)cyclopentylidene]but-2-enoate |
| SMILES | C=C(CCC=O)CC[C@]1(C)CC[C@@H](C(C)(C)O)/C1=C\C=C\C(=O)OC |
| InChI | InChI=1S/C21H32O4/c1-16(8-7-15-22)11-13-21(4)14-12-17(20(2,3)24)18(21)9-6-10-19(23)25-5/h6,9-10,15,17,24H,1,7-8,11-14H2,2-5H3/b10-6+,18-9+/t17-,21-/m1/s1 |
| InChIKey | GRMHEZANUNVCDN-LSKLNASISA-N |
| XLogP | 4.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|