C20H23NO3 — CID 102457240
tert-butyl (4R)-4-naphthalen-2-yl-2-oxopiperidine-1-carboxylate (PubChem CID 102457240) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl (4R)-4-naphthalen-2-yl-2-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (4R)-4-naphthalen-2-yl-2-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102457240 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | tert-butyl (4R)-4-naphthalen-2-yl-2-oxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](c2ccc3ccccc3c2)CC1=O |
| InChI | InChI=1S/C20H23NO3/c1-20(2,3)24-19(23)21-11-10-17(13-18(21)22)16-9-8-14-6-4-5-7-15(14)12-16/h4-9,12,17H,10-11,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | ODUDZANNXJPBHC-QGZVFWFLSA-N |
| XLogP | 4.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |