C14H16F3NO4 — CID 102460174
methyl 2-morpholin-4-yl-2-[4-(trifluoromethoxy)phenyl]acetate (PubChem CID 102460174) has the molecular formula C14H16F3NO4 and a molecular weight of 319.28 g/mol. Its IUPAC name is methyl 2-morpholin-4-yl-2-[4-(trifluoromethoxy)phenyl]acetate.
| Compound Name | methyl 2-morpholin-4-yl-2-[4-(trifluoromethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 102460174 |
| Molecular Formula | C14H16F3NO4 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl 2-morpholin-4-yl-2-[4-(trifluoromethoxy)phenyl]acetate |
| SMILES | COC(=O)C(c1ccc(OC(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C14H16F3NO4/c1-20-13(19)12(18-6-8-21-9-7-18)10-2-4-11(5-3-10)22-14(15,16)17/h2-5,12H,6-9H2,1H3 |
| InChIKey | WXMBBRQVXKPFOT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |